C20H24N2O3 — CID 4112239
[2-[(2,3-dimethylcyclohexyl)amino]-2-oxoethyl] quinoline-2-carboxylate (PubChem CID 4112239) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is [2-[(2,3-dimethylcyclohexyl)amino]-2-oxoethyl] quinoline-2-carboxylate.
| Compound Name | [2-[(2,3-dimethylcyclohexyl)amino]-2-oxoethyl] quinoline-2-carboxylate |
|---|---|
| PubChem CID | 4112239 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | [2-[(2,3-dimethylcyclohexyl)amino]-2-oxoethyl] quinoline-2-carboxylate |
| SMILES | CC1CCCC(NC(=O)COC(=O)c2ccc3ccccc3n2)C1C |
| InChI | InChI=1S/C20H24N2O3/c1-13-6-5-9-16(14(13)2)22-19(23)12-25-20(24)18-11-10-15-7-3-4-8-17(15)21-18/h3-4,7-8,10-11,13-14,16H,5-6,9,12H2,1-2H3,(H,22,23) |
| InChIKey | VFIDFOVKSRXZKZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |