About N,N-dimethyl-9,10-dioxoanthracene-1-sulfonamide
N,N-dimethyl-9,10-dioxoanthracene-1-sulfonamide (PubChem CID 4112659) has the molecular formula C16H13NO4S
and a molecular weight of 315.35 g/mol. Its IUPAC name is N,N-dimethyl-9,10-dioxoanthracene-1-sulfonamide.
Molecular Properties
| Compound Name | N,N-dimethyl-9,10-dioxoanthracene-1-sulfonamide |
| PubChem CID | 4112659 |
| Molecular Formula | C16H13NO4S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | N,N-dimethyl-9,10-dioxoanthracene-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)c1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C16H13NO4S/c1-17(2)22(20,21)13-9-5-8-12-14(13)16(19)11-7-4-3-6-10(11)15(12)18/h3-9H,1-2H3 |
| InChIKey | WGJYKDZEWRMWTB-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethyl-9,10-dioxoanthracene-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-9,10-dioxoanthracene-1-sulfonamide?
The IUPAC name of N,N-dimethyl-9,10-dioxoanthracene-1-sulfonamide (CID 4112659) is N,N-dimethyl-9,10-dioxoanthracene-1-sulfonamide.
What is the SMILES notation for N,N-dimethyl-9,10-dioxoanthracene-1-sulfonamide?
The canonical SMILES for N,N-dimethyl-9,10-dioxoanthracene-1-sulfonamide is CN(C)S(=O)(=O)c1cccc2c1C(=O)c1ccccc1C2=O.
What is the InChIKey of N,N-dimethyl-9,10-dioxoanthracene-1-sulfonamide?
The InChIKey is WGJYKDZEWRMWTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO4S/c1-17(2)22(20,21)13-9-5-8-12-14(13)16(19)11-7-4-3-6-10(11)15(12)18/h3-9H,1-2H3.
What are the key properties of N,N-dimethyl-9,10-dioxoanthracene-1-sulfonamide?
N,N-dimethyl-9,10-dioxoanthracene-1-sulfonamide has a molecular weight of 315.35 g/mol, XLogP of 1.71, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-9,10-dioxoanthracene-1-sulfonamide is sourced from PubChem (CID 4112659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).