C20H23ClN4O — CID 4112952
N-butyl-6-[(3-chlorophenyl)methyl]-5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 4112952) has the molecular formula C20H23ClN4O and a molecular weight of 370.88 g/mol. Its IUPAC name is N-butyl-6-[(3-chlorophenyl)methyl]-5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | N-butyl-6-[(3-chlorophenyl)methyl]-5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 4112952 |
| Molecular Formula | C20H23ClN4O |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | N-butyl-6-[(3-chlorophenyl)methyl]-5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | CCCCNC(=O)c1cnn2c(C)c(Cc3cccc(Cl)c3)c(C)nc12 |
| InChI | InChI=1S/C20H23ClN4O/c1-4-5-9-22-20(26)18-12-23-25-14(3)17(13(2)24-19(18)25)11-15-7-6-8-16(21)10-15/h6-8,10,12H,4-5,9,11H2,1-3H3,(H,22,26) |
| InChIKey | JJUQJAWUUVACQV-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|