C20H20BrN3O3S — CID 41132652
(4R)-4-(3-bromophenyl)-N-(2,5-dimethoxyphenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxamide (PubChem CID 41132652) has the molecular formula C20H20BrN3O3S and a molecular weight of 462.37 g/mol. Its IUPAC name is (4R)-4-(3-bromophenyl)-N-(2,5-dimethoxyphenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxamide.
| Compound Name | (4R)-4-(3-bromophenyl)-N-(2,5-dimethoxyphenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 41132652 |
| Molecular Formula | C20H20BrN3O3S |
| Molecular Weight | 462.37 g/mol |
| Exact Mass | 461.04 |
| IUPAC Name | (4R)-4-(3-bromophenyl)-N-(2,5-dimethoxyphenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxamide |
| SMILES | COc1ccc(OC)c(NC(=O)C2=C(C)NC(=S)N[C@@H]2c2cccc(Br)c2)c1 |
| InChI | InChI=1S/C20H20BrN3O3S/c1-11-17(18(24-20(28)22-11)12-5-4-6-13(21)9-12)19(25)23-15-10-14(26-2)7-8-16(15)27-3/h4-10,18H,1-3H3,(H,23,25)(H2,22,24,28)/t18-/m1/s1 |
| InChIKey | YNFDLFBRPBULOG-GOSISDBHSA-N |
| XLogP | 3.90 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.37 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|