About ethyl 1-[2-(2,4-dimethoxyanilino)-2-oxoethyl]-2-methyl-5-phenylpyrrole-3-carboxylate
ethyl 1-[2-(2,4-dimethoxyanilino)-2-oxoethyl]-2-methyl-5-phenylpyrrole-3-carboxylate (PubChem CID 4113328) has the molecular formula C24H26N2O5
and a molecular weight of 422.48 g/mol. Its IUPAC name is ethyl 1-[2-(2,4-dimethoxyanilino)-2-oxoethyl]-2-methyl-5-phenylpyrrole-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-[2-(2,4-dimethoxyanilino)-2-oxoethyl]-2-methyl-5-phenylpyrrole-3-carboxylate |
| PubChem CID | 4113328 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | ethyl 1-[2-(2,4-dimethoxyanilino)-2-oxoethyl]-2-methyl-5-phenylpyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccccc2)n(CC(=O)Nc2ccc(OC)cc2OC)c1C |
| InChI | InChI=1S/C24H26N2O5/c1-5-31-24(28)19-14-21(17-9-7-6-8-10-17)26(16(19)2)15-23(27)25-20-12-11-18(29-3)13-22(20)30-4/h6-14H,5,15H2,1-4H3,(H,25,27) |
| InChIKey | NUGZHWQXEPACAE-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 1-[2-(2,4-dimethoxyanilino)-2-oxoethyl]-2-methyl-5-phenylpyrrole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-[2-(2,4-dimethoxyanilino)-2-oxoethyl]-2-methyl-5-phenylpyrrole-3-carboxylate?
The IUPAC name of ethyl 1-[2-(2,4-dimethoxyanilino)-2-oxoethyl]-2-methyl-5-phenylpyrrole-3-carboxylate (CID 4113328) is ethyl 1-[2-(2,4-dimethoxyanilino)-2-oxoethyl]-2-methyl-5-phenylpyrrole-3-carboxylate.
What is the SMILES notation for ethyl 1-[2-(2,4-dimethoxyanilino)-2-oxoethyl]-2-methyl-5-phenylpyrrole-3-carboxylate?
The canonical SMILES for ethyl 1-[2-(2,4-dimethoxyanilino)-2-oxoethyl]-2-methyl-5-phenylpyrrole-3-carboxylate is CCOC(=O)c1cc(-c2ccccc2)n(CC(=O)Nc2ccc(OC)cc2OC)c1C.
What is the InChIKey of ethyl 1-[2-(2,4-dimethoxyanilino)-2-oxoethyl]-2-methyl-5-phenylpyrrole-3-carboxylate?
The InChIKey is NUGZHWQXEPACAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26N2O5/c1-5-31-24(28)19-14-21(17-9-7-6-8-10-17)26(16(19)2)15-23(27)25-20-12-11-18(29-3)13-22(20)30-4/h6-14H,5,15H2,1-4H3,(H,25,27).
What are the key properties of ethyl 1-[2-(2,4-dimethoxyanilino)-2-oxoethyl]-2-methyl-5-phenylpyrrole-3-carboxylate?
ethyl 1-[2-(2,4-dimethoxyanilino)-2-oxoethyl]-2-methyl-5-phenylpyrrole-3-carboxylate has a molecular weight of 422.48 g/mol, XLogP of 4.30, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-[2-(2,4-dimethoxyanilino)-2-oxoethyl]-2-methyl-5-phenylpyrrole-3-carboxylate is sourced from PubChem (CID 4113328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).