C19H19FN4O3 — CID 4113403
N-(4-fluorophenyl)-3-[2-[2-(3-methylanilino)-2-oxoacetyl]hydrazinyl]but-3-enamide (PubChem CID 4113403) has the molecular formula C19H19FN4O3 and a molecular weight of 370.38 g/mol. Its IUPAC name is N-(4-fluorophenyl)-3-[2-[2-(3-methylanilino)-2-oxoacetyl]hydrazinyl]but-3-enamide.
| Compound Name | N-(4-fluorophenyl)-3-[2-[2-(3-methylanilino)-2-oxoacetyl]hydrazinyl]but-3-enamide |
|---|---|
| PubChem CID | 4113403 |
| Molecular Formula | C19H19FN4O3 |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | N-(4-fluorophenyl)-3-[2-[2-(3-methylanilino)-2-oxoacetyl]hydrazinyl]but-3-enamide |
| SMILES | C=C(CC(=O)Nc1ccc(F)cc1)NNC(=O)C(=O)Nc1cccc(C)c1 |
| InChI | InChI=1S/C19H19FN4O3/c1-12-4-3-5-16(10-12)22-18(26)19(27)24-23-13(2)11-17(25)21-15-8-6-14(20)7-9-15/h3-10,23H,2,11H2,1H3,(H,21,25)(H,22,26)(H,24,27) |
| InChIKey | BGINYMIRHWRIOM-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|