C24H22N2O3 — CID 4113412
3-(4-methoxyphenyl)-2-(2-prop-2-enoxyphenyl)-1,2-dihydroquinazolin-4-one (PubChem CID 4113412) has the molecular formula C24H22N2O3 and a molecular weight of 386.45 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-2-(2-prop-2-enoxyphenyl)-1,2-dihydroquinazolin-4-one.
| Compound Name | 3-(4-methoxyphenyl)-2-(2-prop-2-enoxyphenyl)-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 4113412 |
| Molecular Formula | C24H22N2O3 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 3-(4-methoxyphenyl)-2-(2-prop-2-enoxyphenyl)-1,2-dihydroquinazolin-4-one |
| SMILES | C=CCOc1ccccc1C1Nc2ccccc2C(=O)N1c1ccc(OC)cc1 |
| InChI | InChI=1S/C24H22N2O3/c1-3-16-29-22-11-7-5-9-20(22)23-25-21-10-6-4-8-19(21)24(27)26(23)17-12-14-18(28-2)15-13-17/h3-15,23,25H,1,16H2,2H3 |
| InChIKey | DVVFINMEGXSAQU-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|