C21H27N3O4S — CID 41136774
ethyl (2R)-4-[4-(3-methoxyphenyl)piperazin-1-yl]-2-(4-methyl-1,3-thiazol-2-yl)-3-oxobutanoate (PubChem CID 41136774) has the molecular formula C21H27N3O4S and a molecular weight of 417.53 g/mol. Its IUPAC name is ethyl (2R)-4-[4-(3-methoxyphenyl)piperazin-1-yl]-2-(4-methyl-1,3-thiazol-2-yl)-3-oxobutanoate.
| Compound Name | ethyl (2R)-4-[4-(3-methoxyphenyl)piperazin-1-yl]-2-(4-methyl-1,3-thiazol-2-yl)-3-oxobutanoate |
|---|---|
| PubChem CID | 41136774 |
| Molecular Formula | C21H27N3O4S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | ethyl (2R)-4-[4-(3-methoxyphenyl)piperazin-1-yl]-2-(4-methyl-1,3-thiazol-2-yl)-3-oxobutanoate |
| SMILES | CCOC(=O)[C@@H](C(=O)CN1CCN(c2cccc(OC)c2)CC1)c1nc(C)cs1 |
| InChI | InChI=1S/C21H27N3O4S/c1-4-28-21(26)19(20-22-15(2)14-29-20)18(25)13-23-8-10-24(11-9-23)16-6-5-7-17(12-16)27-3/h5-7,12,14,19H,4,8-11,13H2,1-3H3/t19-/m0/s1 |
| InChIKey | KKDKFEZPGQPCRL-IBGZPJMESA-N |
| XLogP | 2.50 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|