C21H20Cl2FN3O3S — CID 41137309
N-[(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]-1-(1,1-dioxo-1,2-benzothiazol-3-yl)piperidine-4-carboxamide (PubChem CID 41137309) has the molecular formula C21H20Cl2FN3O3S and a molecular weight of 484.38 g/mol. Its IUPAC name is N-[(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]-1-(1,1-dioxo-1,2-benzothiazol-3-yl)piperidine-4-carboxamide.
| Compound Name | N-[(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]-1-(1,1-dioxo-1,2-benzothiazol-3-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 41137309 |
| Molecular Formula | C21H20Cl2FN3O3S |
| Molecular Weight | 484.38 g/mol |
| Exact Mass | 483.06 |
| IUPAC Name | N-[(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]-1-(1,1-dioxo-1,2-benzothiazol-3-yl)piperidine-4-carboxamide |
| SMILES | C[C@@H](NC(=O)C1CCN(C2=NS(=O)(=O)c3ccccc32)CC1)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C21H20Cl2FN3O3S/c1-12(15-10-18(24)17(23)11-16(15)22)25-21(28)13-6-8-27(9-7-13)20-14-4-2-3-5-19(14)31(29,30)26-20/h2-5,10-13H,6-9H2,1H3,(H,25,28)/t12-/m1/s1 |
| InChIKey | PUHXJEXOFKNGOO-GFCCVEGCSA-N |
| XLogP | 4.17 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.38 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|