C9H12N4 — CID 4113847
1,5,6-trimethylimidazo[4,5-b]pyridin-2-amine (PubChem CID 4113847) has the molecular formula C9H12N4 and a molecular weight of 176.22 g/mol. Its IUPAC name is 1,5,6-trimethylimidazo[4,5-b]pyridin-2-amine.
| Compound Name | 1,5,6-trimethylimidazo[4,5-b]pyridin-2-amine |
|---|---|
| PubChem CID | 4113847 |
| Molecular Formula | C9H12N4 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | 1,5,6-trimethylimidazo[4,5-b]pyridin-2-amine |
| SMILES | Cc1cc2c(nc1C)nc(N)n2C |
| InChI | InChI=1S/C9H12N4/c1-5-4-7-8(11-6(5)2)12-9(10)13(7)3/h4H,1-3H3,(H2,10,11,12) |
| InChIKey | GWMHBZDOVFZVQC-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |