C12H21N5O2 — CID 4113877
N'-[5-(cyclohexylamino)-1,3,4-oxadiazol-2-yl]butanehydrazide (PubChem CID 4113877) has the molecular formula C12H21N5O2 and a molecular weight of 267.33 g/mol. Its IUPAC name is N'-[5-(cyclohexylamino)-1,3,4-oxadiazol-2-yl]butanehydrazide.
| Compound Name | N'-[5-(cyclohexylamino)-1,3,4-oxadiazol-2-yl]butanehydrazide |
|---|---|
| PubChem CID | 4113877 |
| Molecular Formula | C12H21N5O2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | N'-[5-(cyclohexylamino)-1,3,4-oxadiazol-2-yl]butanehydrazide |
| SMILES | CCCC(=O)NNc1nnc(NC2CCCCC2)o1 |
| InChI | InChI=1S/C12H21N5O2/c1-2-6-10(18)14-16-12-17-15-11(19-12)13-9-7-4-3-5-8-9/h9H,2-8H2,1H3,(H,13,15)(H,14,18)(H,16,17) |
| InChIKey | PMNNDRVFTKSOLB-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|