C27H28N4O3S — CID 41139085
N-[(1S)-1-(4-imidazol-1-ylphenyl)ethyl]-1-naphthalen-2-ylsulfonylpiperidine-4-carboxamide (PubChem CID 41139085) has the molecular formula C27H28N4O3S and a molecular weight of 488.61 g/mol. Its IUPAC name is N-[(1S)-1-(4-imidazol-1-ylphenyl)ethyl]-1-naphthalen-2-ylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-[(1S)-1-(4-imidazol-1-ylphenyl)ethyl]-1-naphthalen-2-ylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 41139085 |
| Molecular Formula | C27H28N4O3S |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | N-[(1S)-1-(4-imidazol-1-ylphenyl)ethyl]-1-naphthalen-2-ylsulfonylpiperidine-4-carboxamide |
| SMILES | C[C@H](NC(=O)C1CCN(S(=O)(=O)c2ccc3ccccc3c2)CC1)c1ccc(-n2ccnc2)cc1 |
| InChI | InChI=1S/C27H28N4O3S/c1-20(21-6-9-25(10-7-21)30-17-14-28-19-30)29-27(32)23-12-15-31(16-13-23)35(33,34)26-11-8-22-4-2-3-5-24(22)18-26/h2-11,14,17-20,23H,12-13,15-16H2,1H3,(H,29,32)/t20-/m0/s1 |
| InChIKey | ODCGEBTZEKQPAT-FQEVSTJZSA-N |
| XLogP | 4.30 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |