C30H37N5O5S2 — CID 4113996
N-[3-(acetamidocarbamoyl)-6-propyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl]-4-[benzyl(propan-2-yl)sulfamoyl]benzamide (PubChem CID 4113996) has the molecular formula C30H37N5O5S2 and a molecular weight of 611.79 g/mol. Its IUPAC name is N-[3-(acetamidocarbamoyl)-6-propyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl]-4-[benzyl(propan-2-yl)sulfamoyl]benzamide.
| Compound Name | N-[3-(acetamidocarbamoyl)-6-propyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl]-4-[benzyl(propan-2-yl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 4113996 |
| Molecular Formula | C30H37N5O5S2 |
| Molecular Weight | 611.79 g/mol |
| Exact Mass | 611.22 |
| IUPAC Name | N-[3-(acetamidocarbamoyl)-6-propyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl]-4-[benzyl(propan-2-yl)sulfamoyl]benzamide |
| SMILES | CCCN1CCc2c(sc(NC(=O)c3ccc(S(=O)(=O)N(Cc4ccccc4)C(C)C)cc3)c2C(=O)NNC(C)=O)C1 |
| InChI | InChI=1S/C30H37N5O5S2/c1-5-16-34-17-15-25-26(19-34)41-30(27(25)29(38)33-32-21(4)36)31-28(37)23-11-13-24(14-12-23)42(39,40)35(20(2)3)18-22-9-7-6-8-10-22/h6-14,20H,5,15-19H2,1-4H3,(H,31,37)(H,32,36)(H,33,38) |
| InChIKey | KQQRNPCOMAHNLL-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 127.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.79 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|