C20H27N3O3 — CID 41143774
(5R)-5-methyl-3-[(2S)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl]-5-(4-propylphenyl)imidazolidine-2,4-dione (PubChem CID 41143774) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is (5R)-5-methyl-3-[(2S)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl]-5-(4-propylphenyl)imidazolidine-2,4-dione.
| Compound Name | (5R)-5-methyl-3-[(2S)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl]-5-(4-propylphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 41143774 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | (5R)-5-methyl-3-[(2S)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl]-5-(4-propylphenyl)imidazolidine-2,4-dione |
| SMILES | CCCc1ccc([C@@]2(C)NC(=O)N([C@@H](C)C(=O)N3CCCC3)C2=O)cc1 |
| InChI | InChI=1S/C20H27N3O3/c1-4-7-15-8-10-16(11-9-15)20(3)18(25)23(19(26)21-20)14(2)17(24)22-12-5-6-13-22/h8-11,14H,4-7,12-13H2,1-3H3,(H,21,26)/t14-,20+/m0/s1 |
| InChIKey | NGEUIQYZHPLFHK-VBKZILBWSA-N |
| XLogP | 2.42 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|