C33H39NO — CID 41145069
N-[[(1S,4aR,10aR)-1,4a-dimethyl-6-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]-2-phenylbenzamide (PubChem CID 41145069) has the molecular formula C33H39NO and a molecular weight of 465.68 g/mol. Its IUPAC name is N-[[(1S,4aR,10aR)-1,4a-dimethyl-6-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]-2-phenylbenzamide.
| Compound Name | N-[[(1S,4aR,10aR)-1,4a-dimethyl-6-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]-2-phenylbenzamide |
|---|---|
| PubChem CID | 41145069 |
| Molecular Formula | C33H39NO |
| Molecular Weight | 465.68 g/mol |
| Exact Mass | 465.30 |
| IUPAC Name | N-[[(1S,4aR,10aR)-1,4a-dimethyl-6-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]-2-phenylbenzamide |
| SMILES | CC(C)c1ccc2c(c1)[C@]1(C)CCC[C@](C)(CNC(=O)c3ccccc3-c3ccccc3)[C@@H]1CC2 |
| InChI | InChI=1S/C33H39NO/c1-23(2)26-16-15-25-17-18-30-32(3,19-10-20-33(30,4)29(25)21-26)22-34-31(35)28-14-9-8-13-27(28)24-11-6-5-7-12-24/h5-9,11-16,21,23,30H,10,17-20,22H2,1-4H3,(H,34,35)/t30-,32+,33-/m0/s1 |
| InChIKey | ZNZBVPWKVSFDBC-SIABPNFTSA-N |
| XLogP | 7.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.68 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |