C18H23N3O4 — CID 4114738
N-[3-(cyclopentanecarbonylamino)-4-nitrophenyl]cyclopentanecarboxamide (PubChem CID 4114738) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is N-[3-(cyclopentanecarbonylamino)-4-nitrophenyl]cyclopentanecarboxamide.
| Compound Name | N-[3-(cyclopentanecarbonylamino)-4-nitrophenyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 4114738 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | N-[3-(cyclopentanecarbonylamino)-4-nitrophenyl]cyclopentanecarboxamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])c(NC(=O)C2CCCC2)c1)C1CCCC1 |
| InChI | InChI=1S/C18H23N3O4/c22-17(12-5-1-2-6-12)19-14-9-10-16(21(24)25)15(11-14)20-18(23)13-7-3-4-8-13/h9-13H,1-8H2,(H,19,22)(H,20,23) |
| InChIKey | CTYRRCGRGAKPFS-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|