C10H8F9NO2S — CID 4115139
2,2-difluoro-2-(2,3,3,4,4,5,5-heptafluorooxolan-2-yl)-1-thiomorpholin-4-ylethanone (PubChem CID 4115139) has the molecular formula C10H8F9NO2S and a molecular weight of 377.23 g/mol. Its IUPAC name is 2,2-difluoro-2-(2,3,3,4,4,5,5-heptafluorooxolan-2-yl)-1-thiomorpholin-4-ylethanone.
| Compound Name | 2,2-difluoro-2-(2,3,3,4,4,5,5-heptafluorooxolan-2-yl)-1-thiomorpholin-4-ylethanone |
|---|---|
| PubChem CID | 4115139 |
| Molecular Formula | C10H8F9NO2S |
| Molecular Weight | 377.23 g/mol |
| Exact Mass | 377.01 |
| IUPAC Name | 2,2-difluoro-2-(2,3,3,4,4,5,5-heptafluorooxolan-2-yl)-1-thiomorpholin-4-ylethanone |
| SMILES | O=C(N1CCSCC1)C(F)(F)C1(F)OC(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C10H8F9NO2S/c11-6(12,5(21)20-1-3-23-4-2-20)9(17)7(13,14)8(15,16)10(18,19)22-9/h1-4H2 |
| InChIKey | WLTYBAPFZADURV-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.23 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|