C20H31NO — CID 4115175
N-octyl-3-(4-propan-2-ylphenyl)prop-2-enamide (PubChem CID 4115175) has the molecular formula C20H31NO and a molecular weight of 301.47 g/mol. Its IUPAC name is N-octyl-3-(4-propan-2-ylphenyl)prop-2-enamide.
| Compound Name | N-octyl-3-(4-propan-2-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 4115175 |
| Molecular Formula | C20H31NO |
| Molecular Weight | 301.47 g/mol |
| Exact Mass | 301.24 |
| IUPAC Name | N-octyl-3-(4-propan-2-ylphenyl)prop-2-enamide |
| SMILES | CCCCCCCCNC(=O)C=Cc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C20H31NO/c1-4-5-6-7-8-9-16-21-20(22)15-12-18-10-13-19(14-11-18)17(2)3/h10-15,17H,4-9,16H2,1-3H3,(H,21,22) |
| InChIKey | AQYVKBYZOWKVRG-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.47 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|