C18H15IN2OS2 — CID 41151826
N-[4-(4-iodophenyl)-1,3-thiazol-2-yl]-2-(4-methylphenyl)sulfanylacetamide (PubChem CID 41151826) has the molecular formula C18H15IN2OS2 and a molecular weight of 466.37 g/mol. Its IUPAC name is N-[4-(4-iodophenyl)-1,3-thiazol-2-yl]-2-(4-methylphenyl)sulfanylacetamide.
| Compound Name | N-[4-(4-iodophenyl)-1,3-thiazol-2-yl]-2-(4-methylphenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 41151826 |
| Molecular Formula | C18H15IN2OS2 |
| Molecular Weight | 466.37 g/mol |
| Exact Mass | 465.97 |
| IUPAC Name | N-[4-(4-iodophenyl)-1,3-thiazol-2-yl]-2-(4-methylphenyl)sulfanylacetamide |
| SMILES | Cc1ccc(SCC(=O)Nc2nc(-c3ccc(I)cc3)cs2)cc1 |
| InChI | InChI=1S/C18H15IN2OS2/c1-12-2-8-15(9-3-12)23-11-17(22)21-18-20-16(10-24-18)13-4-6-14(19)7-5-13/h2-10H,11H2,1H3,(H,20,21,22) |
| InChIKey | ODLJYHHEPSZRKU-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.37 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|