C21H22N4O7S — CID 41152151
ethyl (4R)-6-[[4-(ethylamino)-3-nitrobenzoyl]oxymethyl]-2-oxo-4-thiophen-2-yl-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 41152151) has the molecular formula C21H22N4O7S and a molecular weight of 474.50 g/mol. Its IUPAC name is ethyl (4R)-6-[[4-(ethylamino)-3-nitrobenzoyl]oxymethyl]-2-oxo-4-thiophen-2-yl-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl (4R)-6-[[4-(ethylamino)-3-nitrobenzoyl]oxymethyl]-2-oxo-4-thiophen-2-yl-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 41152151 |
| Molecular Formula | C21H22N4O7S |
| Molecular Weight | 474.50 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | ethyl (4R)-6-[[4-(ethylamino)-3-nitrobenzoyl]oxymethyl]-2-oxo-4-thiophen-2-yl-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCNc1ccc(C(=O)OCC2=C(C(=O)OCC)[C@H](c3cccs3)NC(=O)N2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H22N4O7S/c1-3-22-13-8-7-12(10-15(13)25(29)30)19(26)32-11-14-17(20(27)31-4-2)18(24-21(28)23-14)16-6-5-9-33-16/h5-10,18,22H,3-4,11H2,1-2H3,(H2,23,24,28)/t18-/m0/s1 |
| InChIKey | UOZULMNYGISXRW-SFHVURJKSA-N |
| XLogP | 3.12 |
| TPSA | 148.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.50 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|