C25H29ClN4O4 — CID 41153593
(5S)-3-[2-[(3S)-5-(4-chlorophenyl)-3-(furan-2-yl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-5-hexyl-5-methylimidazolidine-2,4-dione (PubChem CID 41153593) has the molecular formula C25H29ClN4O4 and a molecular weight of 484.98 g/mol. Its IUPAC name is (5S)-3-[2-[(3S)-5-(4-chlorophenyl)-3-(furan-2-yl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-5-hexyl-5-methylimidazolidine-2,4-dione.
| Compound Name | (5S)-3-[2-[(3S)-5-(4-chlorophenyl)-3-(furan-2-yl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-5-hexyl-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 41153593 |
| Molecular Formula | C25H29ClN4O4 |
| Molecular Weight | 484.98 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | (5S)-3-[2-[(3S)-5-(4-chlorophenyl)-3-(furan-2-yl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl]-5-hexyl-5-methylimidazolidine-2,4-dione |
| SMILES | CCCCCC[C@]1(C)NC(=O)N(CC(=O)N2N=C(c3ccc(Cl)cc3)C[C@H]2c2ccco2)C1=O |
| InChI | InChI=1S/C25H29ClN4O4/c1-3-4-5-6-13-25(2)23(32)29(24(33)27-25)16-22(31)30-20(21-8-7-14-34-21)15-19(28-30)17-9-11-18(26)12-10-17/h7-12,14,20H,3-6,13,15-16H2,1-2H3,(H,27,33)/t20-,25-/m0/s1 |
| InChIKey | KGWUOBTZGQEIOG-CPJSRVTESA-N |
| XLogP | 4.89 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.98 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|