C23H29N3O6S — CID 41155916
1-[2-(cyclohexen-1-yl)ethyl]-3-[2-[1-[(3R)-1,1-dioxothiolan-3-yl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]imidazolidine-2,4,5-trione (PubChem CID 41155916) has the molecular formula C23H29N3O6S and a molecular weight of 475.57 g/mol. Its IUPAC name is 1-[2-(cyclohexen-1-yl)ethyl]-3-[2-[1-[(3R)-1,1-dioxothiolan-3-yl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]imidazolidine-2,4,5-trione.
| Compound Name | 1-[2-(cyclohexen-1-yl)ethyl]-3-[2-[1-[(3R)-1,1-dioxothiolan-3-yl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 41155916 |
| Molecular Formula | C23H29N3O6S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | 1-[2-(cyclohexen-1-yl)ethyl]-3-[2-[1-[(3R)-1,1-dioxothiolan-3-yl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]imidazolidine-2,4,5-trione |
| SMILES | Cc1cc(C(=O)CN2C(=O)C(=O)N(CCC3=CCCCC3)C2=O)c(C)n1[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C23H29N3O6S/c1-15-12-19(16(2)26(15)18-9-11-33(31,32)14-18)20(27)13-25-22(29)21(28)24(23(25)30)10-8-17-6-4-3-5-7-17/h6,12,18H,3-5,7-11,13-14H2,1-2H3/t18-/m1/s1 |
| InChIKey | WTIJEAOEZDSSFH-GOSISDBHSA-N |
| XLogP | 2.33 |
| TPSA | 113.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|