C20H20FN5O2S2 — CID 41155920
N'-[(2R)-2-[[4-cyclopropyl-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]propanoyl]-4-fluorobenzohydrazide (PubChem CID 41155920) has the molecular formula C20H20FN5O2S2 and a molecular weight of 445.55 g/mol. Its IUPAC name is N'-[(2R)-2-[[4-cyclopropyl-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]propanoyl]-4-fluorobenzohydrazide.
| Compound Name | N'-[(2R)-2-[[4-cyclopropyl-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]propanoyl]-4-fluorobenzohydrazide |
|---|---|
| PubChem CID | 41155920 |
| Molecular Formula | C20H20FN5O2S2 |
| Molecular Weight | 445.55 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | N'-[(2R)-2-[[4-cyclopropyl-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]propanoyl]-4-fluorobenzohydrazide |
| SMILES | C[C@@H](Sc1nnc(Cc2cccs2)n1C1CC1)C(=O)NNC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H20FN5O2S2/c1-12(18(27)23-24-19(28)13-4-6-14(21)7-5-13)30-20-25-22-17(26(20)15-8-9-15)11-16-3-2-10-29-16/h2-7,10,12,15H,8-9,11H2,1H3,(H,23,27)(H,24,28)/t12-/m1/s1 |
| InChIKey | MKGMJVJGFDMBOD-GFCCVEGCSA-N |
| XLogP | 3.35 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.55 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|