C20H19Cl2N3O2S — CID 41155921
N-(2,6-dichloro-3-methylphenyl)-2-[(7R)-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl]acetamide (PubChem CID 41155921) has the molecular formula C20H19Cl2N3O2S and a molecular weight of 436.36 g/mol. Its IUPAC name is N-(2,6-dichloro-3-methylphenyl)-2-[(7R)-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl]acetamide.
| Compound Name | N-(2,6-dichloro-3-methylphenyl)-2-[(7R)-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl]acetamide |
|---|---|
| PubChem CID | 41155921 |
| Molecular Formula | C20H19Cl2N3O2S |
| Molecular Weight | 436.36 g/mol |
| Exact Mass | 435.06 |
| IUPAC Name | N-(2,6-dichloro-3-methylphenyl)-2-[(7R)-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl]acetamide |
| SMILES | Cc1ccc(Cl)c(NC(=O)Cn2cnc3sc4c(c3c2=O)CC[C@@H](C)C4)c1Cl |
| InChI | InChI=1S/C20H19Cl2N3O2S/c1-10-3-5-12-14(7-10)28-19-16(12)20(27)25(9-23-19)8-15(26)24-18-13(21)6-4-11(2)17(18)22/h4,6,9-10H,3,5,7-8H2,1-2H3,(H,24,26)/t10-/m1/s1 |
| InChIKey | NKLGBBKDJMTUNM-SNVBAGLBSA-N |
| XLogP | 4.84 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.36 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |