C25H19N3O2S — CID 4115989
16-(4-methoxyphenyl)-5-phenyl-8-thia-3,5,10-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2(7),3,9,11(15)-pentaen-6-one (PubChem CID 4115989) has the molecular formula C25H19N3O2S and a molecular weight of 425.51 g/mol. Its IUPAC name is 16-(4-methoxyphenyl)-5-phenyl-8-thia-3,5,10-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2(7),3,9,11(15)-pentaen-6-one.
| Compound Name | 16-(4-methoxyphenyl)-5-phenyl-8-thia-3,5,10-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2(7),3,9,11(15)-pentaen-6-one |
|---|---|
| PubChem CID | 4115989 |
| Molecular Formula | C25H19N3O2S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | 16-(4-methoxyphenyl)-5-phenyl-8-thia-3,5,10-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2(7),3,9,11(15)-pentaen-6-one |
| SMILES | COc1ccc(-c2c3c(nc4sc5c(=O)n(-c6ccccc6)cnc5c24)CCC3)cc1 |
| InChI | InChI=1S/C25H19N3O2S/c1-30-17-12-10-15(11-13-17)20-18-8-5-9-19(18)27-24-21(20)22-23(31-24)25(29)28(14-26-22)16-6-3-2-4-7-16/h2-4,6-7,10-14H,5,8-9H2,1H3 |
| InChIKey | FQKXSIUCLIMOBX-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |