C17H11Cl2N3O — CID 41160220
2-[1-[(3,4-dichlorophenyl)methyl]indol-2-yl]-1,3,4-oxadiazole (PubChem CID 41160220) has the molecular formula C17H11Cl2N3O and a molecular weight of 344.20 g/mol. Its IUPAC name is 2-[1-[(3,4-dichlorophenyl)methyl]indol-2-yl]-1,3,4-oxadiazole.
| Compound Name | 2-[1-[(3,4-dichlorophenyl)methyl]indol-2-yl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 41160220 |
| Molecular Formula | C17H11Cl2N3O |
| Molecular Weight | 344.20 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | 2-[1-[(3,4-dichlorophenyl)methyl]indol-2-yl]-1,3,4-oxadiazole |
| SMILES | Clc1ccc(Cn2c(-c3nnco3)cc3ccccc32)cc1Cl |
| InChI | InChI=1S/C17H11Cl2N3O/c18-13-6-5-11(7-14(13)19)9-22-15-4-2-1-3-12(15)8-16(22)17-21-20-10-23-17/h1-8,10H,9H2 |
| InChIKey | ADZDOMDLSCTTRL-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.20 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |