C17H18N6O2S2 — CID 41160279
2-[[7-(4-ethoxyphenyl)-5,6-dihydroimidazo[2,1-c][1,2,4]triazol-3-yl]sulfanyl]-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 41160279) has the molecular formula C17H18N6O2S2 and a molecular weight of 402.51 g/mol. Its IUPAC name is 2-[[7-(4-ethoxyphenyl)-5,6-dihydroimidazo[2,1-c][1,2,4]triazol-3-yl]sulfanyl]-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[[7-(4-ethoxyphenyl)-5,6-dihydroimidazo[2,1-c][1,2,4]triazol-3-yl]sulfanyl]-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 41160279 |
| Molecular Formula | C17H18N6O2S2 |
| Molecular Weight | 402.51 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | 2-[[7-(4-ethoxyphenyl)-5,6-dihydroimidazo[2,1-c][1,2,4]triazol-3-yl]sulfanyl]-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | CCOc1ccc(N2CCn3c(SCC(=O)Nc4nccs4)nnc32)cc1 |
| InChI | InChI=1S/C17H18N6O2S2/c1-2-25-13-5-3-12(4-6-13)22-8-9-23-16(22)20-21-17(23)27-11-14(24)19-15-18-7-10-26-15/h3-7,10H,2,8-9,11H2,1H3,(H,18,19,24) |
| InChIKey | OKWFDBVZXDXDRO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.51 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |