About 4,6-dichloro-2,5-diphenylpyrimidine
4,6-dichloro-2,5-diphenylpyrimidine (PubChem CID 4116137) has the molecular formula C16H10Cl2N2
and a molecular weight of 301.18 g/mol. Its IUPAC name is 4,6-dichloro-2,5-diphenylpyrimidine.
Molecular Properties
| Compound Name | 4,6-dichloro-2,5-diphenylpyrimidine |
| PubChem CID | 4116137 |
| Molecular Formula | C16H10Cl2N2 |
| Molecular Weight | 301.18 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | 4,6-dichloro-2,5-diphenylpyrimidine |
| SMILES | Clc1nc(-c2ccccc2)nc(Cl)c1-c1ccccc1 |
| InChI | InChI=1S/C16H10Cl2N2/c17-14-13(11-7-3-1-4-8-11)15(18)20-16(19-14)12-9-5-2-6-10-12/h1-10H |
| InChIKey | SYZDNTMHIDTVBR-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 301.18 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,6-dichloro-2,5-diphenylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dichloro-2,5-diphenylpyrimidine?
The IUPAC name of 4,6-dichloro-2,5-diphenylpyrimidine (CID 4116137) is 4,6-dichloro-2,5-diphenylpyrimidine.
What is the SMILES notation for 4,6-dichloro-2,5-diphenylpyrimidine?
The canonical SMILES for 4,6-dichloro-2,5-diphenylpyrimidine is Clc1nc(-c2ccccc2)nc(Cl)c1-c1ccccc1.
What is the InChIKey of 4,6-dichloro-2,5-diphenylpyrimidine?
The InChIKey is SYZDNTMHIDTVBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10Cl2N2/c17-14-13(11-7-3-1-4-8-11)15(18)20-16(19-14)12-9-5-2-6-10-12/h1-10H.
What are the key properties of 4,6-dichloro-2,5-diphenylpyrimidine?
4,6-dichloro-2,5-diphenylpyrimidine has a molecular weight of 301.18 g/mol, XLogP of 5.12, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dichloro-2,5-diphenylpyrimidine is sourced from PubChem (CID 4116137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).