About 6-pyridin-4-yl-1,2-dihydropyrazolo[3,4-b]pyridin-3-one
6-pyridin-4-yl-1,2-dihydropyrazolo[3,4-b]pyridin-3-one (PubChem CID 4116193) has the molecular formula C11H8N4O
and a molecular weight of 212.21 g/mol. Its IUPAC name is 6-pyridin-4-yl-1,2-dihydropyrazolo[3,4-b]pyridin-3-one.
Molecular Properties
| Compound Name | 6-pyridin-4-yl-1,2-dihydropyrazolo[3,4-b]pyridin-3-one |
| PubChem CID | 4116193 |
| Molecular Formula | C11H8N4O |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 6-pyridin-4-yl-1,2-dihydropyrazolo[3,4-b]pyridin-3-one |
| SMILES | O=c1[nH][nH]c2nc(-c3ccncc3)ccc12 |
| InChI | InChI=1S/C11H8N4O/c16-11-8-1-2-9(13-10(8)14-15-11)7-3-5-12-6-4-7/h1-6H,(H2,13,14,15,16) |
| InChIKey | APHGDDRQPIRLTR-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-pyridin-4-yl-1,2-dihydropyrazolo[3,4-b]pyridin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-pyridin-4-yl-1,2-dihydropyrazolo[3,4-b]pyridin-3-one?
The IUPAC name of 6-pyridin-4-yl-1,2-dihydropyrazolo[3,4-b]pyridin-3-one (CID 4116193) is 6-pyridin-4-yl-1,2-dihydropyrazolo[3,4-b]pyridin-3-one.
What is the SMILES notation for 6-pyridin-4-yl-1,2-dihydropyrazolo[3,4-b]pyridin-3-one?
The canonical SMILES for 6-pyridin-4-yl-1,2-dihydropyrazolo[3,4-b]pyridin-3-one is O=c1[nH][nH]c2nc(-c3ccncc3)ccc12.
What is the InChIKey of 6-pyridin-4-yl-1,2-dihydropyrazolo[3,4-b]pyridin-3-one?
The InChIKey is APHGDDRQPIRLTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N4O/c16-11-8-1-2-9(13-10(8)14-15-11)7-3-5-12-6-4-7/h1-6H,(H2,13,14,15,16).
What are the key properties of 6-pyridin-4-yl-1,2-dihydropyrazolo[3,4-b]pyridin-3-one?
6-pyridin-4-yl-1,2-dihydropyrazolo[3,4-b]pyridin-3-one has a molecular weight of 212.21 g/mol, XLogP of 1.31, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-pyridin-4-yl-1,2-dihydropyrazolo[3,4-b]pyridin-3-one is sourced from PubChem (CID 4116193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).