C26H26N2O3 — CID 41162791
2-(4-benzoylphenoxy)-1-[4-(3-methylphenyl)piperazin-1-yl]ethanone (PubChem CID 41162791) has the molecular formula C26H26N2O3 and a molecular weight of 414.51 g/mol. Its IUPAC name is 2-(4-benzoylphenoxy)-1-[4-(3-methylphenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(4-benzoylphenoxy)-1-[4-(3-methylphenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 41162791 |
| Molecular Formula | C26H26N2O3 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 2-(4-benzoylphenoxy)-1-[4-(3-methylphenyl)piperazin-1-yl]ethanone |
| SMILES | Cc1cccc(N2CCN(C(=O)COc3ccc(C(=O)c4ccccc4)cc3)CC2)c1 |
| InChI | InChI=1S/C26H26N2O3/c1-20-6-5-9-23(18-20)27-14-16-28(17-15-27)25(29)19-31-24-12-10-22(11-13-24)26(30)21-7-3-2-4-8-21/h2-13,18H,14-17,19H2,1H3 |
| InChIKey | GSLWTBXWJQMQRM-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |