About N-[[5-(2,4-dimethoxyphenyl)-1H-pyrazol-4-yl]methylideneamino]furan-2-carboxamide
N-[[5-(2,4-dimethoxyphenyl)-1H-pyrazol-4-yl]methylideneamino]furan-2-carboxamide (PubChem CID 4116440) has the molecular formula C17H16N4O4
and a molecular weight of 340.34 g/mol. Its IUPAC name is N-[[5-(2,4-dimethoxyphenyl)-1H-pyrazol-4-yl]methylideneamino]furan-2-carboxamide.
Molecular Properties
| Compound Name | N-[[5-(2,4-dimethoxyphenyl)-1H-pyrazol-4-yl]methylideneamino]furan-2-carboxamide |
| PubChem CID | 4116440 |
| Molecular Formula | C17H16N4O4 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | N-[[5-(2,4-dimethoxyphenyl)-1H-pyrazol-4-yl]methylideneamino]furan-2-carboxamide |
| SMILES | COc1ccc(-c2[nH]ncc2C=NNC(=O)c2ccco2)c(OC)c1 |
| InChI | InChI=1S/C17H16N4O4/c1-23-12-5-6-13(15(8-12)24-2)16-11(9-18-20-16)10-19-21-17(22)14-4-3-7-25-14/h3-10H,1-2H3,(H,18,20)(H,21,22) |
| InChIKey | FOUKTPKKVFPVDM-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[[5-(2,4-dimethoxyphenyl)-1H-pyrazol-4-yl]methylideneamino]furan-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[5-(2,4-dimethoxyphenyl)-1H-pyrazol-4-yl]methylideneamino]furan-2-carboxamide?
The IUPAC name of N-[[5-(2,4-dimethoxyphenyl)-1H-pyrazol-4-yl]methylideneamino]furan-2-carboxamide (CID 4116440) is N-[[5-(2,4-dimethoxyphenyl)-1H-pyrazol-4-yl]methylideneamino]furan-2-carboxamide.
What is the SMILES notation for N-[[5-(2,4-dimethoxyphenyl)-1H-pyrazol-4-yl]methylideneamino]furan-2-carboxamide?
The canonical SMILES for N-[[5-(2,4-dimethoxyphenyl)-1H-pyrazol-4-yl]methylideneamino]furan-2-carboxamide is COc1ccc(-c2[nH]ncc2C=NNC(=O)c2ccco2)c(OC)c1.
What is the InChIKey of N-[[5-(2,4-dimethoxyphenyl)-1H-pyrazol-4-yl]methylideneamino]furan-2-carboxamide?
The InChIKey is FOUKTPKKVFPVDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N4O4/c1-23-12-5-6-13(15(8-12)24-2)16-11(9-18-20-16)10-19-21-17(22)14-4-3-7-25-14/h3-10H,1-2H3,(H,18,20)(H,21,22).
What are the key properties of N-[[5-(2,4-dimethoxyphenyl)-1H-pyrazol-4-yl]methylideneamino]furan-2-carboxamide?
N-[[5-(2,4-dimethoxyphenyl)-1H-pyrazol-4-yl]methylideneamino]furan-2-carboxamide has a molecular weight of 340.34 g/mol, XLogP of 2.45, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[5-(2,4-dimethoxyphenyl)-1H-pyrazol-4-yl]methylideneamino]furan-2-carboxamide is sourced from PubChem (CID 4116440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).