About 7-bromoheptanimidamide
7-bromoheptanimidamide (PubChem CID 4116633) has the molecular formula C7H15BrN2
and a molecular weight of 207.11 g/mol. Its IUPAC name is 7-bromoheptanimidamide.
Molecular Properties
| Compound Name | 7-bromoheptanimidamide |
| PubChem CID | 4116633 |
| Molecular Formula | C7H15BrN2 |
| Molecular Weight | 207.11 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | 7-bromoheptanimidamide |
| SMILES | [H]/N=C(\N)CCCCCCBr |
| InChI | InChI=1S/C7H15BrN2/c8-6-4-2-1-3-5-7(9)10/h1-6H2,(H3,9,10) |
| InChIKey | PBKNYUGZWVZPCG-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.11 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 7-bromoheptanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromoheptanimidamide?
The IUPAC name of 7-bromoheptanimidamide (CID 4116633) is 7-bromoheptanimidamide.
What is the SMILES notation for 7-bromoheptanimidamide?
The canonical SMILES for 7-bromoheptanimidamide is [H]/N=C(\N)CCCCCCBr.
What is the InChIKey of 7-bromoheptanimidamide?
The InChIKey is PBKNYUGZWVZPCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15BrN2/c8-6-4-2-1-3-5-7(9)10/h1-6H2,(H3,9,10).
What are the key properties of 7-bromoheptanimidamide?
7-bromoheptanimidamide has a molecular weight of 207.11 g/mol, XLogP of 2.27, 6 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromoheptanimidamide is sourced from PubChem (CID 4116633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).