C27H22N2O5S — CID 4116855
methyl 1-(4-ethoxyphenyl)-2,3-dioxo-4-phenyl-5H-pyrrolo[2,3-b][1,5]benzothiazepine-10a-carboxylate (PubChem CID 4116855) has the molecular formula C27H22N2O5S and a molecular weight of 486.55 g/mol. Its IUPAC name is methyl 1-(4-ethoxyphenyl)-2,3-dioxo-4-phenyl-5H-pyrrolo[2,3-b][1,5]benzothiazepine-10a-carboxylate.
| Compound Name | methyl 1-(4-ethoxyphenyl)-2,3-dioxo-4-phenyl-5H-pyrrolo[2,3-b][1,5]benzothiazepine-10a-carboxylate |
|---|---|
| PubChem CID | 4116855 |
| Molecular Formula | C27H22N2O5S |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | methyl 1-(4-ethoxyphenyl)-2,3-dioxo-4-phenyl-5H-pyrrolo[2,3-b][1,5]benzothiazepine-10a-carboxylate |
| SMILES | CCOc1ccc(N2C(=O)C(=O)C3=C(c4ccccc4)Nc4ccccc4SC32C(=O)OC)cc1 |
| InChI | InChI=1S/C27H22N2O5S/c1-3-34-19-15-13-18(14-16-19)29-25(31)24(30)22-23(17-9-5-4-6-10-17)28-20-11-7-8-12-21(20)35-27(22,29)26(32)33-2/h4-16,28H,3H2,1-2H3 |
| InChIKey | ULVDTRRUDINQTA-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|