C26H20N2O4S — CID 4116858
methyl 4-(4-methylphenyl)-2,3-dioxo-1-phenyl-5H-pyrrolo[2,3-b][1,5]benzothiazepine-10a-carboxylate (PubChem CID 4116858) has the molecular formula C26H20N2O4S and a molecular weight of 456.52 g/mol. Its IUPAC name is methyl 4-(4-methylphenyl)-2,3-dioxo-1-phenyl-5H-pyrrolo[2,3-b][1,5]benzothiazepine-10a-carboxylate.
| Compound Name | methyl 4-(4-methylphenyl)-2,3-dioxo-1-phenyl-5H-pyrrolo[2,3-b][1,5]benzothiazepine-10a-carboxylate |
|---|---|
| PubChem CID | 4116858 |
| Molecular Formula | C26H20N2O4S |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | methyl 4-(4-methylphenyl)-2,3-dioxo-1-phenyl-5H-pyrrolo[2,3-b][1,5]benzothiazepine-10a-carboxylate |
| SMILES | COC(=O)C12Sc3ccccc3NC(c3ccc(C)cc3)=C1C(=O)C(=O)N2c1ccccc1 |
| InChI | InChI=1S/C26H20N2O4S/c1-16-12-14-17(15-13-16)22-21-23(29)24(30)28(18-8-4-3-5-9-18)26(21,25(31)32-2)33-20-11-7-6-10-19(20)27-22/h3-15,27H,1-2H3 |
| InChIKey | HQXGHRVYDMBWQS-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|