C20H22ClN3O6S — CID 41168645
(3R)-1-(3-chloro-4-methoxyphenyl)sulfonyl-N-(2-methyl-3-nitrophenyl)piperidine-3-carboxamide (PubChem CID 41168645) has the molecular formula C20H22ClN3O6S and a molecular weight of 467.93 g/mol. Its IUPAC name is (3R)-1-(3-chloro-4-methoxyphenyl)sulfonyl-N-(2-methyl-3-nitrophenyl)piperidine-3-carboxamide.
| Compound Name | (3R)-1-(3-chloro-4-methoxyphenyl)sulfonyl-N-(2-methyl-3-nitrophenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 41168645 |
| Molecular Formula | C20H22ClN3O6S |
| Molecular Weight | 467.93 g/mol |
| Exact Mass | 467.09 |
| IUPAC Name | (3R)-1-(3-chloro-4-methoxyphenyl)sulfonyl-N-(2-methyl-3-nitrophenyl)piperidine-3-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCC[C@@H](C(=O)Nc3cccc([N+](=O)[O-])c3C)C2)cc1Cl |
| InChI | InChI=1S/C20H22ClN3O6S/c1-13-17(6-3-7-18(13)24(26)27)22-20(25)14-5-4-10-23(12-14)31(28,29)15-8-9-19(30-2)16(21)11-15/h3,6-9,11,14H,4-5,10,12H2,1-2H3,(H,22,25)/t14-/m1/s1 |
| InChIKey | SXJJCRDGLVAYES-CQSZACIVSA-N |
| XLogP | 3.60 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.93 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|