C23H27N5OS2 — CID 41170614
(2R)-2-[(4-cyclopropyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]-N-(4-piperidin-1-ylphenyl)propanamide (PubChem CID 41170614) has the molecular formula C23H27N5OS2 and a molecular weight of 453.64 g/mol. Its IUPAC name is (2R)-2-[(4-cyclopropyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]-N-(4-piperidin-1-ylphenyl)propanamide.
| Compound Name | (2R)-2-[(4-cyclopropyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]-N-(4-piperidin-1-ylphenyl)propanamide |
|---|---|
| PubChem CID | 41170614 |
| Molecular Formula | C23H27N5OS2 |
| Molecular Weight | 453.64 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | (2R)-2-[(4-cyclopropyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]-N-(4-piperidin-1-ylphenyl)propanamide |
| SMILES | C[C@@H](Sc1nnc(-c2cccs2)n1C1CC1)C(=O)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C23H27N5OS2/c1-16(22(29)24-17-7-9-18(10-8-17)27-13-3-2-4-14-27)31-23-26-25-21(20-6-5-15-30-20)28(23)19-11-12-19/h5-10,15-16,19H,2-4,11-14H2,1H3,(H,24,29)/t16-/m1/s1 |
| InChIKey | AVNHXSZDMDHRGC-MRXNPFEDSA-N |
| XLogP | 5.45 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.64 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|