C22H19N3O2S — CID 4117193
2-(4-oxo-6-phenylthieno[2,3-d]pyrimidin-3-yl)-N-(1-phenylethyl)acetamide (PubChem CID 4117193) has the molecular formula C22H19N3O2S and a molecular weight of 389.48 g/mol. Its IUPAC name is 2-(4-oxo-6-phenylthieno[2,3-d]pyrimidin-3-yl)-N-(1-phenylethyl)acetamide.
| Compound Name | 2-(4-oxo-6-phenylthieno[2,3-d]pyrimidin-3-yl)-N-(1-phenylethyl)acetamide |
|---|---|
| PubChem CID | 4117193 |
| Molecular Formula | C22H19N3O2S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 2-(4-oxo-6-phenylthieno[2,3-d]pyrimidin-3-yl)-N-(1-phenylethyl)acetamide |
| SMILES | CC(NC(=O)Cn1cnc2sc(-c3ccccc3)cc2c1=O)c1ccccc1 |
| InChI | InChI=1S/C22H19N3O2S/c1-15(16-8-4-2-5-9-16)24-20(26)13-25-14-23-21-18(22(25)27)12-19(28-21)17-10-6-3-7-11-17/h2-12,14-15H,13H2,1H3,(H,24,26) |
| InChIKey | RRHKLOUPUGLVBO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |