C31H25N3O2S — CID 4117252
N-(furan-2-ylmethyl)-N-[2-(6-naphthalen-2-ylimidazo[2,1-b][1,3]thiazol-3-yl)ethyl]-3-phenylprop-2-enamide (PubChem CID 4117252) has the molecular formula C31H25N3O2S and a molecular weight of 503.63 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N-[2-(6-naphthalen-2-ylimidazo[2,1-b][1,3]thiazol-3-yl)ethyl]-3-phenylprop-2-enamide.
| Compound Name | N-(furan-2-ylmethyl)-N-[2-(6-naphthalen-2-ylimidazo[2,1-b][1,3]thiazol-3-yl)ethyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 4117252 |
| Molecular Formula | C31H25N3O2S |
| Molecular Weight | 503.63 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | N-(furan-2-ylmethyl)-N-[2-(6-naphthalen-2-ylimidazo[2,1-b][1,3]thiazol-3-yl)ethyl]-3-phenylprop-2-enamide |
| SMILES | O=C(C=Cc1ccccc1)N(CCc1csc2nc(-c3ccc4ccccc4c3)cn12)Cc1ccco1 |
| InChI | InChI=1S/C31H25N3O2S/c35-30(15-12-23-7-2-1-3-8-23)33(20-28-11-6-18-36-28)17-16-27-22-37-31-32-29(21-34(27)31)26-14-13-24-9-4-5-10-25(24)19-26/h1-15,18-19,21-22H,16-17,20H2 |
| InChIKey | KXRMIJJAIKRCKG-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 50.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.63 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|