C11H16N2OS — CID 4117618
N-pentyl-2-sulfanylidene-1H-pyridine-3-carboxamide (PubChem CID 4117618) has the molecular formula C11H16N2OS and a molecular weight of 224.33 g/mol. Its IUPAC name is N-pentyl-2-sulfanylidene-1H-pyridine-3-carboxamide.
| Compound Name | N-pentyl-2-sulfanylidene-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 4117618 |
| Molecular Formula | C11H16N2OS |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | N-pentyl-2-sulfanylidene-1H-pyridine-3-carboxamide |
| SMILES | CCCCCNC(=O)c1ccc[nH]c1=S |
| InChI | InChI=1S/C11H16N2OS/c1-2-3-4-7-12-10(14)9-6-5-8-13-11(9)15/h5-6,8H,2-4,7H2,1H3,(H,12,14)(H,13,15) |
| InChIKey | MDEAINCIALUBQO-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|