C21H20N3OS+ — CID 4117632
12-(4-methylsulfanylphenyl)-2,3,5,6,12,12a-hexahydrobenzimidazolo[2,1-b]quinazolin-11-ium-1-one (PubChem CID 4117632) has the molecular formula C21H20N3OS+ and a molecular weight of 362.48 g/mol. Its IUPAC name is 12-(4-methylsulfanylphenyl)-2,3,5,6,12,12a-hexahydrobenzimidazolo[2,1-b]quinazolin-11-ium-1-one.
| Compound Name | 12-(4-methylsulfanylphenyl)-2,3,5,6,12,12a-hexahydrobenzimidazolo[2,1-b]quinazolin-11-ium-1-one |
|---|---|
| PubChem CID | 4117632 |
| Molecular Formula | C21H20N3OS+ |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 12-(4-methylsulfanylphenyl)-2,3,5,6,12,12a-hexahydrobenzimidazolo[2,1-b]quinazolin-11-ium-1-one |
| SMILES | CSc1ccc(C2C3C(=O)CCC=C3Nc3[nH]c4ccccc4[n+]32)cc1 |
| InChI | InChI=1S/C21H19N3OS/c1-26-14-11-9-13(10-12-14)20-19-16(6-4-8-18(19)25)23-21-22-15-5-2-3-7-17(15)24(20)21/h2-3,5-7,9-12,19-20H,4,8H2,1H3,(H,22,23)/p+1 |
| InChIKey | VBTOMUUQJYZCDT-UHFFFAOYSA-O |
| XLogP | 4.06 |
| TPSA | 48.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|