C26H20N6O3 — CID 4118176
15-methyl-17-(4-methylphenyl)-13-(4-nitrophenyl)-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,10,12(16),14-hexaen-9-one (PubChem CID 4118176) has the molecular formula C26H20N6O3 and a molecular weight of 464.49 g/mol. Its IUPAC name is 15-methyl-17-(4-methylphenyl)-13-(4-nitrophenyl)-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,10,12(16),14-hexaen-9-one.
| Compound Name | 15-methyl-17-(4-methylphenyl)-13-(4-nitrophenyl)-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,10,12(16),14-hexaen-9-one |
|---|---|
| PubChem CID | 4118176 |
| Molecular Formula | C26H20N6O3 |
| Molecular Weight | 464.49 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | 15-methyl-17-(4-methylphenyl)-13-(4-nitrophenyl)-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,10,12(16),14-hexaen-9-one |
| SMILES | Cc1ccc(C2c3c(C)nn(-c4ccc([N+](=O)[O-])cc4)c3N=C3C(=O)Nc4ccccc4N32)cc1 |
| InChI | InChI=1S/C26H20N6O3/c1-15-7-9-17(10-8-15)23-22-16(2)29-31(18-11-13-19(14-12-18)32(34)35)24(22)28-25-26(33)27-20-5-3-4-6-21(20)30(23)25/h3-14,23H,1-2H3,(H,27,33) |
| InChIKey | CRJLQWDHIDWDDI-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 105.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.49 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|