C22H23N2O+ — CID 41187377
(2S)-1-carbazol-9-yl-3-(2,4-dimethylpyridin-1-ium-1-yl)propan-2-ol (PubChem CID 41187377) has the molecular formula C22H23N2O+ and a molecular weight of 331.44 g/mol. Its IUPAC name is (2S)-1-carbazol-9-yl-3-(2,4-dimethylpyridin-1-ium-1-yl)propan-2-ol.
| Compound Name | (2S)-1-carbazol-9-yl-3-(2,4-dimethylpyridin-1-ium-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 41187377 |
| Molecular Formula | C22H23N2O+ |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | (2S)-1-carbazol-9-yl-3-(2,4-dimethylpyridin-1-ium-1-yl)propan-2-ol |
| SMILES | Cc1cc[n+](C[C@@H](O)Cn2c3ccccc3c3ccccc32)c(C)c1 |
| InChI | InChI=1S/C22H23N2O/c1-16-11-12-23(17(2)13-16)14-18(25)15-24-21-9-5-3-7-19(21)20-8-4-6-10-22(20)24/h3-13,18,25H,14-15H2,1-2H3/q+1/t18-/m1/s1 |
| InChIKey | RGKBIDHJXGFYKQ-GOSISDBHSA-N |
| XLogP | 3.76 |
| TPSA | 29.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|