About [2-(2-bromo-4,6-difluoroanilino)-2-oxoethyl] 3-aminopyrazine-2-carboxylate
[2-(2-bromo-4,6-difluoroanilino)-2-oxoethyl] 3-aminopyrazine-2-carboxylate (PubChem CID 41188027) has the molecular formula C13H9BrF2N4O3
and a molecular weight of 387.14 g/mol. Its IUPAC name is [2-(2-bromo-4,6-difluoroanilino)-2-oxoethyl] 3-aminopyrazine-2-carboxylate.
Molecular Properties
| Compound Name | [2-(2-bromo-4,6-difluoroanilino)-2-oxoethyl] 3-aminopyrazine-2-carboxylate |
| PubChem CID | 41188027 |
| Molecular Formula | C13H9BrF2N4O3 |
| Molecular Weight | 387.14 g/mol |
| Exact Mass | 385.98 |
| IUPAC Name | [2-(2-bromo-4,6-difluoroanilino)-2-oxoethyl] 3-aminopyrazine-2-carboxylate |
| SMILES | Nc1nccnc1C(=O)OCC(=O)Nc1c(F)cc(F)cc1Br |
| InChI | InChI=1S/C13H9BrF2N4O3/c14-7-3-6(15)4-8(16)10(7)20-9(21)5-23-13(22)11-12(17)19-2-1-18-11/h1-4H,5H2,(H2,17,19)(H,20,21) |
| InChIKey | MYROTPAEFYILRS-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.14 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-(2-bromo-4,6-difluoroanilino)-2-oxoethyl] 3-aminopyrazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-bromo-4,6-difluoroanilino)-2-oxoethyl] 3-aminopyrazine-2-carboxylate?
The IUPAC name of [2-(2-bromo-4,6-difluoroanilino)-2-oxoethyl] 3-aminopyrazine-2-carboxylate (CID 41188027) is [2-(2-bromo-4,6-difluoroanilino)-2-oxoethyl] 3-aminopyrazine-2-carboxylate.
What is the SMILES notation for [2-(2-bromo-4,6-difluoroanilino)-2-oxoethyl] 3-aminopyrazine-2-carboxylate?
The canonical SMILES for [2-(2-bromo-4,6-difluoroanilino)-2-oxoethyl] 3-aminopyrazine-2-carboxylate is Nc1nccnc1C(=O)OCC(=O)Nc1c(F)cc(F)cc1Br.
What is the InChIKey of [2-(2-bromo-4,6-difluoroanilino)-2-oxoethyl] 3-aminopyrazine-2-carboxylate?
The InChIKey is MYROTPAEFYILRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9BrF2N4O3/c14-7-3-6(15)4-8(16)10(7)20-9(21)5-23-13(22)11-12(17)19-2-1-18-11/h1-4H,5H2,(H2,17,19)(H,20,21).
What are the key properties of [2-(2-bromo-4,6-difluoroanilino)-2-oxoethyl] 3-aminopyrazine-2-carboxylate?
[2-(2-bromo-4,6-difluoroanilino)-2-oxoethyl] 3-aminopyrazine-2-carboxylate has a molecular weight of 387.14 g/mol, XLogP of 1.89, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-bromo-4,6-difluoroanilino)-2-oxoethyl] 3-aminopyrazine-2-carboxylate is sourced from PubChem (CID 41188027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).