About 1,4-bis(bromomethyl)-2,5-dimethoxybenzene
1,4-bis(bromomethyl)-2,5-dimethoxybenzene (PubChem CID 4119143) has the molecular formula C10H12Br2O2
and a molecular weight of 324.01 g/mol. Its IUPAC name is 1,4-bis(bromomethyl)-2,5-dimethoxybenzene.
Molecular Properties
| Compound Name | 1,4-bis(bromomethyl)-2,5-dimethoxybenzene |
| PubChem CID | 4119143 |
| Molecular Formula | C10H12Br2O2 |
| Molecular Weight | 324.01 g/mol |
| Exact Mass | 321.92 |
| IUPAC Name | 1,4-bis(bromomethyl)-2,5-dimethoxybenzene |
| SMILES | COc1cc(CBr)c(OC)cc1CBr |
| InChI | InChI=1S/C10H12Br2O2/c1-13-9-3-8(6-12)10(14-2)4-7(9)5-11/h3-4H,5-6H2,1-2H3 |
| InChIKey | YONSJCAXAJEYGM-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.01 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,4-bis(bromomethyl)-2,5-dimethoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-bis(bromomethyl)-2,5-dimethoxybenzene?
The IUPAC name of 1,4-bis(bromomethyl)-2,5-dimethoxybenzene (CID 4119143) is 1,4-bis(bromomethyl)-2,5-dimethoxybenzene.
What is the SMILES notation for 1,4-bis(bromomethyl)-2,5-dimethoxybenzene?
The canonical SMILES for 1,4-bis(bromomethyl)-2,5-dimethoxybenzene is COc1cc(CBr)c(OC)cc1CBr.
What is the InChIKey of 1,4-bis(bromomethyl)-2,5-dimethoxybenzene?
The InChIKey is YONSJCAXAJEYGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12Br2O2/c1-13-9-3-8(6-12)10(14-2)4-7(9)5-11/h3-4H,5-6H2,1-2H3.
What are the key properties of 1,4-bis(bromomethyl)-2,5-dimethoxybenzene?
1,4-bis(bromomethyl)-2,5-dimethoxybenzene has a molecular weight of 324.01 g/mol, XLogP of 3.49, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-bis(bromomethyl)-2,5-dimethoxybenzene is sourced from PubChem (CID 4119143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).