About 2-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-[(1R)-1-cyclopropylethyl]acetamide
2-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-[(1R)-1-cyclopropylethyl]acetamide (PubChem CID 41192192) has the molecular formula C13H16N4OS2
and a molecular weight of 308.43 g/mol. Its IUPAC name is 2-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-[(1R)-1-cyclopropylethyl]acetamide.
Molecular Properties
| Compound Name | 2-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-[(1R)-1-cyclopropylethyl]acetamide |
| PubChem CID | 41192192 |
| Molecular Formula | C13H16N4OS2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 2-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-[(1R)-1-cyclopropylethyl]acetamide |
| SMILES | C[C@@H](NC(=O)CSc1nc(N)c2ccsc2n1)C1CC1 |
| InChI | InChI=1S/C13H16N4OS2/c1-7(8-2-3-8)15-10(18)6-20-13-16-11(14)9-4-5-19-12(9)17-13/h4-5,7-8H,2-3,6H2,1H3,(H,15,18)(H2,14,16,17)/t7-/m1/s1 |
| InChIKey | YGWBDVZHTVRKCK-SSDOTTSWSA-N |
| XLogP | 2.28 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-[(1R)-1-cyclopropylethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-[(1R)-1-cyclopropylethyl]acetamide?
The IUPAC name of 2-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-[(1R)-1-cyclopropylethyl]acetamide (CID 41192192) is 2-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-[(1R)-1-cyclopropylethyl]acetamide.
What is the SMILES notation for 2-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-[(1R)-1-cyclopropylethyl]acetamide?
The canonical SMILES for 2-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-[(1R)-1-cyclopropylethyl]acetamide is C[C@@H](NC(=O)CSc1nc(N)c2ccsc2n1)C1CC1.
What is the InChIKey of 2-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-[(1R)-1-cyclopropylethyl]acetamide?
The InChIKey is YGWBDVZHTVRKCK-SSDOTTSWSA-N. The full InChI is InChI=1S/C13H16N4OS2/c1-7(8-2-3-8)15-10(18)6-20-13-16-11(14)9-4-5-19-12(9)17-13/h4-5,7-8H,2-3,6H2,1H3,(H,15,18)(H2,14,16,17)/t7-/m1/s1.
What are the key properties of 2-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-[(1R)-1-cyclopropylethyl]acetamide?
2-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-[(1R)-1-cyclopropylethyl]acetamide has a molecular weight of 308.43 g/mol, XLogP of 2.28, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-[(1R)-1-cyclopropylethyl]acetamide is sourced from PubChem (CID 41192192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).