C22H23N3O3 — CID 41192456
N-(2-oxo-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)-N'-[(1S)-1-phenylethyl]oxamide (PubChem CID 41192456) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is N-(2-oxo-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)-N'-[(1S)-1-phenylethyl]oxamide.
| Compound Name | N-(2-oxo-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)-N'-[(1S)-1-phenylethyl]oxamide |
|---|---|
| PubChem CID | 41192456 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | N-(2-oxo-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)-N'-[(1S)-1-phenylethyl]oxamide |
| SMILES | C[C@H](NC(=O)C(=O)Nc1cc2c3c(c1)CCC(=O)N3CCC2)c1ccccc1 |
| InChI | InChI=1S/C22H23N3O3/c1-14(15-6-3-2-4-7-15)23-21(27)22(28)24-18-12-16-8-5-11-25-19(26)10-9-17(13-18)20(16)25/h2-4,6-7,12-14H,5,8-11H2,1H3,(H,23,27)(H,24,28)/t14-/m0/s1 |
| InChIKey | UKTFJIJZSFBIPO-AWEZNQCLSA-N |
| XLogP | 2.73 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|