C20H22ClFN4O — CID 4119475
N-butyl-6-[(2-chloro-6-fluorophenyl)methyl]-5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 4119475) has the molecular formula C20H22ClFN4O and a molecular weight of 388.87 g/mol. Its IUPAC name is N-butyl-6-[(2-chloro-6-fluorophenyl)methyl]-5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | N-butyl-6-[(2-chloro-6-fluorophenyl)methyl]-5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 4119475 |
| Molecular Formula | C20H22ClFN4O |
| Molecular Weight | 388.87 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | N-butyl-6-[(2-chloro-6-fluorophenyl)methyl]-5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | CCCCNC(=O)c1cnn2c(C)c(Cc3c(F)cccc3Cl)c(C)nc12 |
| InChI | InChI=1S/C20H22ClFN4O/c1-4-5-9-23-20(27)16-11-24-26-13(3)14(12(2)25-19(16)26)10-15-17(21)7-6-8-18(15)22/h6-8,11H,4-5,9-10H2,1-3H3,(H,23,27) |
| InChIKey | JSTIOAPOIGPWNA-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.87 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|