C24H30FN3O4S — CID 41196643
N-[2-[(2R)-1-(4-fluoro-3-methylphenyl)sulfonylpiperidin-2-yl]ethyl]-N'-[(2-methylphenyl)methyl]oxamide (PubChem CID 41196643) has the molecular formula C24H30FN3O4S and a molecular weight of 475.59 g/mol. Its IUPAC name is N-[2-[(2R)-1-(4-fluoro-3-methylphenyl)sulfonylpiperidin-2-yl]ethyl]-N'-[(2-methylphenyl)methyl]oxamide.
| Compound Name | N-[2-[(2R)-1-(4-fluoro-3-methylphenyl)sulfonylpiperidin-2-yl]ethyl]-N'-[(2-methylphenyl)methyl]oxamide |
|---|---|
| PubChem CID | 41196643 |
| Molecular Formula | C24H30FN3O4S |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | N-[2-[(2R)-1-(4-fluoro-3-methylphenyl)sulfonylpiperidin-2-yl]ethyl]-N'-[(2-methylphenyl)methyl]oxamide |
| SMILES | Cc1cc(S(=O)(=O)N2CCCC[C@@H]2CCNC(=O)C(=O)NCc2ccccc2C)ccc1F |
| InChI | InChI=1S/C24H30FN3O4S/c1-17-7-3-4-8-19(17)16-27-24(30)23(29)26-13-12-20-9-5-6-14-28(20)33(31,32)21-10-11-22(25)18(2)15-21/h3-4,7-8,10-11,15,20H,5-6,9,12-14,16H2,1-2H3,(H,26,29)(H,27,30)/t20-/m1/s1 |
| InChIKey | GGAMKUHYUCGKCO-HXUWFJFHSA-N |
| XLogP | 2.81 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|