C20H31FN4O4S — CID 41196962
N'-[2-(dimethylamino)ethyl]-N-[2-[(2R)-1-(4-fluoro-2-methylphenyl)sulfonylpiperidin-2-yl]ethyl]oxamide (PubChem CID 41196962) has the molecular formula C20H31FN4O4S and a molecular weight of 442.56 g/mol. Its IUPAC name is N'-[2-(dimethylamino)ethyl]-N-[2-[(2R)-1-(4-fluoro-2-methylphenyl)sulfonylpiperidin-2-yl]ethyl]oxamide.
| Compound Name | N'-[2-(dimethylamino)ethyl]-N-[2-[(2R)-1-(4-fluoro-2-methylphenyl)sulfonylpiperidin-2-yl]ethyl]oxamide |
|---|---|
| PubChem CID | 41196962 |
| Molecular Formula | C20H31FN4O4S |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | N'-[2-(dimethylamino)ethyl]-N-[2-[(2R)-1-(4-fluoro-2-methylphenyl)sulfonylpiperidin-2-yl]ethyl]oxamide |
| SMILES | Cc1cc(F)ccc1S(=O)(=O)N1CCCC[C@@H]1CCNC(=O)C(=O)NCCN(C)C |
| InChI | InChI=1S/C20H31FN4O4S/c1-15-14-16(21)7-8-18(15)30(28,29)25-12-5-4-6-17(25)9-10-22-19(26)20(27)23-11-13-24(2)3/h7-8,14,17H,4-6,9-13H2,1-3H3,(H,22,26)(H,23,27)/t17-/m1/s1 |
| InChIKey | APBOSWMEMLMUST-QGZVFWFLSA-N |
| XLogP | 0.86 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|