About 3,4-dibutyl-2,5-dithiophen-2-ylthiophene
3,4-dibutyl-2,5-dithiophen-2-ylthiophene (PubChem CID 4120443) has the molecular formula C20H24S3
and a molecular weight of 360.61 g/mol. Its IUPAC name is 3,4-dibutyl-2,5-dithiophen-2-ylthiophene.
Molecular Properties
| Compound Name | 3,4-dibutyl-2,5-dithiophen-2-ylthiophene |
| PubChem CID | 4120443 |
| Molecular Formula | C20H24S3 |
| Molecular Weight | 360.61 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | 3,4-dibutyl-2,5-dithiophen-2-ylthiophene |
| SMILES | CCCCc1c(-c2cccs2)sc(-c2cccs2)c1CCCC |
| InChI | InChI=1S/C20H24S3/c1-3-5-9-15-16(10-6-4-2)20(18-12-8-14-22-18)23-19(15)17-11-7-13-21-17/h7-8,11-14H,3-6,9-10H2,1-2H3 |
| InChIKey | QTYUVJQQHLIDNI-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.61 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,4-dibutyl-2,5-dithiophen-2-ylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dibutyl-2,5-dithiophen-2-ylthiophene?
The IUPAC name of 3,4-dibutyl-2,5-dithiophen-2-ylthiophene (CID 4120443) is 3,4-dibutyl-2,5-dithiophen-2-ylthiophene.
What is the SMILES notation for 3,4-dibutyl-2,5-dithiophen-2-ylthiophene?
The canonical SMILES for 3,4-dibutyl-2,5-dithiophen-2-ylthiophene is CCCCc1c(-c2cccs2)sc(-c2cccs2)c1CCCC.
What is the InChIKey of 3,4-dibutyl-2,5-dithiophen-2-ylthiophene?
The InChIKey is QTYUVJQQHLIDNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24S3/c1-3-5-9-15-16(10-6-4-2)20(18-12-8-14-22-18)23-19(15)17-11-7-13-21-17/h7-8,11-14H,3-6,9-10H2,1-2H3.
What are the key properties of 3,4-dibutyl-2,5-dithiophen-2-ylthiophene?
3,4-dibutyl-2,5-dithiophen-2-ylthiophene has a molecular weight of 360.61 g/mol, XLogP of 7.89, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dibutyl-2,5-dithiophen-2-ylthiophene is sourced from PubChem (CID 4120443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).